1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(1,1-difluoroethyl)benzoate
Modify Date: 2025-10-01 12:27:54
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(1,1-difluoroethyl)benzoate structure
|
Common Name | 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(1,1-difluoroethyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 2248317-20-4 | Molecular Weight | 331.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H11F2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(1,1-difluoroethyl)benzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H11F2NO4 |
|---|---|
| Molecular Weight | 331.27 |
| InChIKey | QTZMAKNNJPLKTA-UHFFFAOYSA-N |
| SMILES | CC(F)(F)c1cccc(C(=O)ON2C(=O)c3ccccc3C2=O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(1,1-difluoroethyl)benzoate? |
| A: Molecular formula of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(1,1-difluoroethyl)benzoate is C17H11F2NO4. |
| Q: What is the InChIKey of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(1,1-difluoroethyl)benzoate? |
| A: InChIKey of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(1,1-difluoroethyl)benzoate is QTZMAKNNJPLKTA-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(1,1-difluoroethyl)benzoate? |
| A: SMILES notation of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(1,1-difluoroethyl)benzoate is CC(F)(F)c1cccc(C(=O)ON2C(=O)c3ccccc3C2=O)c1. |
| Q: What is the Chinese name of 2248317-20-4? |
| A: Chinese name of 2248317-20-4 is 2248317-20-4. |
| Q: What is the CAS number of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(1,1-difluoroethyl)benzoate? |
| A: CAS number of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(1,1-difluoroethyl)benzoate is 2248317-20-4. |
| Q: What is the molecular weight of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(1,1-difluoroethyl)benzoate? |
| A: Molecular weight of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(1,1-difluoroethyl)benzoate is 331.27. |
| Q: What is the English name of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(1,1-difluoroethyl)benzoate? |
| A: The English name of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(1,1-difluoroethyl)benzoate is 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(1,1-difluoroethyl)benzoate. |