1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-phenylpentanoate
Modify Date: 2026-07-05 18:48:35
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-phenylpentanoate structure
|
Common Name | 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-phenylpentanoate | ||
|---|---|---|---|---|
| CAS Number | 2248317-28-2 | Molecular Weight | 323.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-phenylpentanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H17NO4 |
|---|---|
| Molecular Weight | 323.3 |
| InChIKey | KOHBGBZZUWFCCP-UHFFFAOYSA-N |
| SMILES | CCC(CC(=O)ON1C(=O)c2ccccc2C1=O)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-phenylpentanoate? |
| A: SMILES notation of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-phenylpentanoate is CCC(CC(=O)ON1C(=O)c2ccccc2C1=O)c1ccccc1. |
| Q: What is the Chinese name of 2248317-28-2? |
| A: Chinese name of 2248317-28-2 is 2248317-28-2. |
| Q: What is the English name of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-phenylpentanoate? |
| A: The English name of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-phenylpentanoate is 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-phenylpentanoate. |
| Q: What is the molecular weight of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-phenylpentanoate? |
| A: Molecular weight of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-phenylpentanoate is 323.3. |
| Q: What is the InChIKey of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-phenylpentanoate? |
| A: InChIKey of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-phenylpentanoate is KOHBGBZZUWFCCP-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-phenylpentanoate? |
| A: CAS number of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-phenylpentanoate is 2248317-28-2. |
| Q: What is the molecular formula of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-phenylpentanoate? |
| A: Molecular formula of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3-phenylpentanoate is C19H17NO4. |