1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 3-methyl cyclohexane-1,3-dicarboxylate
Modify Date: 2025-10-23 15:40:42
1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 3-methyl cyclohexane-1,3-dicarboxylate structure
|
Common Name | 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 3-methyl cyclohexane-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 2248317-46-4 | Molecular Weight | 331.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 3-methyl cyclohexane-1,3-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H17NO6 |
|---|---|
| Molecular Weight | 331.32 |
| InChIKey | ZBNXUPFBNPPKEI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCCC(C(=O)ON2C(=O)c3ccccc3C2=O)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2248317-46-4? |
| A: Chinese name of 2248317-46-4 is 2248317-46-4. |
| Q: What is the CAS number of 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 3-methyl cyclohexane-1,3-dicarboxylate? |
| A: CAS number of 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 3-methyl cyclohexane-1,3-dicarboxylate is 2248317-46-4. |
| Q: What is the molecular formula of 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 3-methyl cyclohexane-1,3-dicarboxylate? |
| A: Molecular formula of 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 3-methyl cyclohexane-1,3-dicarboxylate is C17H17NO6. |
| Q: What is the InChIKey of 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 3-methyl cyclohexane-1,3-dicarboxylate? |
| A: InChIKey of 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 3-methyl cyclohexane-1,3-dicarboxylate is ZBNXUPFBNPPKEI-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 3-methyl cyclohexane-1,3-dicarboxylate? |
| A: SMILES notation of 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 3-methyl cyclohexane-1,3-dicarboxylate is COC(=O)C1CCCC(C(=O)ON2C(=O)c3ccccc3C2=O)C1. |
| Q: What is the English name of 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 3-methyl cyclohexane-1,3-dicarboxylate? |
| A: The English name of 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 3-methyl cyclohexane-1,3-dicarboxylate is 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 3-methyl cyclohexane-1,3-dicarboxylate. |
| Q: What is the molecular weight of 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 3-methyl cyclohexane-1,3-dicarboxylate? |
| A: Molecular weight of 1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 3-methyl cyclohexane-1,3-dicarboxylate is 331.32. |