Tert-butyl (2S,5S)-5-thiophen-2-ylpyrrolidine-2-carboxylate
Modify Date: 2026-09-28 16:33:07
Tert-butyl (2S,5S)-5-thiophen-2-ylpyrrolidine-2-carboxylate structure
|
Common Name | Tert-butyl (2S,5S)-5-thiophen-2-ylpyrrolidine-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2248317-77-1 | Molecular Weight | 253.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tert-butyl (2S,5S)-5-thiophen-2-ylpyrrolidine-2-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H19NO2S |
|---|---|
| Molecular Weight | 253.36 |
| InChIKey | JGCTUWHQJUTRAY-UWVGGRQHSA-N |
| SMILES | CC(C)(C)OC(=O)C1CCC(c2cccs2)N1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Tert-butyl (2S,5S)-5-thiophen-2-ylpyrrolidine-2-carboxylate? |
| A: InChIKey of Tert-butyl (2S,5S)-5-thiophen-2-ylpyrrolidine-2-carboxylate is JGCTUWHQJUTRAY-UWVGGRQHSA-N. |
| Q: What is the molecular weight of Tert-butyl (2S,5S)-5-thiophen-2-ylpyrrolidine-2-carboxylate? |
| A: Molecular weight of Tert-butyl (2S,5S)-5-thiophen-2-ylpyrrolidine-2-carboxylate is 253.36. |
| Q: What is the SMILES notation of Tert-butyl (2S,5S)-5-thiophen-2-ylpyrrolidine-2-carboxylate? |
| A: SMILES notation of Tert-butyl (2S,5S)-5-thiophen-2-ylpyrrolidine-2-carboxylate is CC(C)(C)OC(=O)C1CCC(c2cccs2)N1. |
| Q: What is the CAS number of Tert-butyl (2S,5S)-5-thiophen-2-ylpyrrolidine-2-carboxylate? |
| A: CAS number of Tert-butyl (2S,5S)-5-thiophen-2-ylpyrrolidine-2-carboxylate is 2248317-77-1. |
| Q: What is the English name of Tert-butyl (2S,5S)-5-thiophen-2-ylpyrrolidine-2-carboxylate? |
| A: The English name of Tert-butyl (2S,5S)-5-thiophen-2-ylpyrrolidine-2-carboxylate is Tert-butyl (2S,5S)-5-thiophen-2-ylpyrrolidine-2-carboxylate. |
| Q: What is the molecular formula of Tert-butyl (2S,5S)-5-thiophen-2-ylpyrrolidine-2-carboxylate? |
| A: Molecular formula of Tert-butyl (2S,5S)-5-thiophen-2-ylpyrrolidine-2-carboxylate is C13H19NO2S. |
| Q: What is the Chinese name of 2248317-77-1? |
| A: Chinese name of 2248317-77-1 is 2248317-77-1. |