1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl cyclooctanecarboxylate
Modify Date: 2026-08-03 15:47:47
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl cyclooctanecarboxylate structure
|
Common Name | 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl cyclooctanecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 2248317-87-3 | Molecular Weight | 301.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl cyclooctanecarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H19NO4 |
|---|---|
| Molecular Weight | 301.34 |
| InChIKey | FGSNMCHOQXYVMO-UHFFFAOYSA-N |
| SMILES | O=C(ON1C(=O)c2ccccc2C1=O)C1CCCCCCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl cyclooctanecarboxylate? |
| A: InChIKey of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl cyclooctanecarboxylate is FGSNMCHOQXYVMO-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl cyclooctanecarboxylate? |
| A: CAS number of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl cyclooctanecarboxylate is 2248317-87-3. |
| Q: What is the English name of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl cyclooctanecarboxylate? |
| A: The English name of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl cyclooctanecarboxylate is 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl cyclooctanecarboxylate. |
| Q: What is the SMILES notation of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl cyclooctanecarboxylate? |
| A: SMILES notation of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl cyclooctanecarboxylate is O=C(ON1C(=O)c2ccccc2C1=O)C1CCCCCCC1. |
| Q: What is the molecular formula of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl cyclooctanecarboxylate? |
| A: Molecular formula of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl cyclooctanecarboxylate is C17H19NO4. |
| Q: What is the molecular weight of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl cyclooctanecarboxylate? |
| A: Molecular weight of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl cyclooctanecarboxylate is 301.34. |
| Q: What is the Chinese name of 2248317-87-3? |
| A: Chinese name of 2248317-87-3 is 2248317-87-3. |