rac-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl (1R,3aS,7aS)-hexahydro-1H-furo[3,4-c]pyran-1-carboxylate structure
|
Common Name | rac-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl (1R,3aS,7aS)-hexahydro-1H-furo[3,4-c]pyran-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2248331-41-9 | Molecular Weight | 317.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rac-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl (1R,3aS,7aS)-hexahydro-1H-furo[3,4-c]pyran-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H15NO6 |
|---|---|
| Molecular Weight | 317.29 |
| InChIKey | CFVRZILMCKUTFJ-OUJBWJOFSA-N |
| SMILES | O=C(ON1C(=O)c2ccccc2C1=O)C1OCC2COCCC21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of rac-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl (1R,3aS,7aS)-hexahydro-1H-furo[3,4-c]pyran-1-carboxylate? |
| A: CAS number of rac-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl (1R,3aS,7aS)-hexahydro-1H-furo[3,4-c]pyran-1-carboxylate is 2248331-41-9. |
| Q: What is the molecular weight of rac-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl (1R,3aS,7aS)-hexahydro-1H-furo[3,4-c]pyran-1-carboxylate? |
| A: Molecular weight of rac-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl (1R,3aS,7aS)-hexahydro-1H-furo[3,4-c]pyran-1-carboxylate is 317.29. |
| Q: What is the English name of rac-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl (1R,3aS,7aS)-hexahydro-1H-furo[3,4-c]pyran-1-carboxylate? |
| A: The English name of rac-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl (1R,3aS,7aS)-hexahydro-1H-furo[3,4-c]pyran-1-carboxylate is rac-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl (1R,3aS,7aS)-hexahydro-1H-furo[3,4-c]pyran-1-carboxylate. |
| Q: What is the Chinese name of 2248331-41-9? |
| A: Chinese name of 2248331-41-9 is 2248331-41-9. |
| Q: What is the molecular formula of rac-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl (1R,3aS,7aS)-hexahydro-1H-furo[3,4-c]pyran-1-carboxylate? |
| A: Molecular formula of rac-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl (1R,3aS,7aS)-hexahydro-1H-furo[3,4-c]pyran-1-carboxylate is C16H15NO6. |
| Q: What is the InChIKey of rac-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl (1R,3aS,7aS)-hexahydro-1H-furo[3,4-c]pyran-1-carboxylate? |
| A: InChIKey of rac-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl (1R,3aS,7aS)-hexahydro-1H-furo[3,4-c]pyran-1-carboxylate is CFVRZILMCKUTFJ-OUJBWJOFSA-N. |
| Q: What is the SMILES notation of rac-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl (1R,3aS,7aS)-hexahydro-1H-furo[3,4-c]pyran-1-carboxylate? |
| A: SMILES notation of rac-1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl (1R,3aS,7aS)-hexahydro-1H-furo[3,4-c]pyran-1-carboxylate is O=C(ON1C(=O)c2ccccc2C1=O)C1OCC2COCCC21. |