1,3-Dioxoisoindolin-2-yl 4,4,4-trifluoro-3,3-dimethylbutanoate
Modify Date: 2025-08-24 09:31:25
1,3-Dioxoisoindolin-2-yl 4,4,4-trifluoro-3,3-dimethylbutanoate structure
|
Common Name | 1,3-Dioxoisoindolin-2-yl 4,4,4-trifluoro-3,3-dimethylbutanoate | ||
|---|---|---|---|---|
| CAS Number | 2248357-64-2 | Molecular Weight | 315.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12F3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-Dioxoisoindolin-2-yl 4,4,4-trifluoro-3,3-dimethylbutanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H12F3NO4 |
|---|---|
| Molecular Weight | 315.24 |
| InChIKey | DKWCVSPVWYWXJU-UHFFFAOYSA-N |
| SMILES | CC(C)(CC(=O)ON1C(=O)c2ccccc2C1=O)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1,3-Dioxoisoindolin-2-yl 4,4,4-trifluoro-3,3-dimethylbutanoate? |
| A: Molecular formula of 1,3-Dioxoisoindolin-2-yl 4,4,4-trifluoro-3,3-dimethylbutanoate is C14H12F3NO4. |
| Q: What is the Chinese name of 2248357-64-2? |
| A: Chinese name of 2248357-64-2 is 2248357-64-2. |
| Q: What is the English name of 1,3-Dioxoisoindolin-2-yl 4,4,4-trifluoro-3,3-dimethylbutanoate? |
| A: The English name of 1,3-Dioxoisoindolin-2-yl 4,4,4-trifluoro-3,3-dimethylbutanoate is 1,3-Dioxoisoindolin-2-yl 4,4,4-trifluoro-3,3-dimethylbutanoate. |
| Q: What is the SMILES notation of 1,3-Dioxoisoindolin-2-yl 4,4,4-trifluoro-3,3-dimethylbutanoate? |
| A: SMILES notation of 1,3-Dioxoisoindolin-2-yl 4,4,4-trifluoro-3,3-dimethylbutanoate is CC(C)(CC(=O)ON1C(=O)c2ccccc2C1=O)C(F)(F)F. |
| Q: What is the InChIKey of 1,3-Dioxoisoindolin-2-yl 4,4,4-trifluoro-3,3-dimethylbutanoate? |
| A: InChIKey of 1,3-Dioxoisoindolin-2-yl 4,4,4-trifluoro-3,3-dimethylbutanoate is DKWCVSPVWYWXJU-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,3-Dioxoisoindolin-2-yl 4,4,4-trifluoro-3,3-dimethylbutanoate? |
| A: CAS number of 1,3-Dioxoisoindolin-2-yl 4,4,4-trifluoro-3,3-dimethylbutanoate is 2248357-64-2. |
| Q: What is the molecular weight of 1,3-Dioxoisoindolin-2-yl 4,4,4-trifluoro-3,3-dimethylbutanoate? |
| A: Molecular weight of 1,3-Dioxoisoindolin-2-yl 4,4,4-trifluoro-3,3-dimethylbutanoate is 315.24. |