Tert-butyl 2-amino-4-tert-butyl-1,3-thiazole-5-carboxylate
Modify Date: 2026-07-05 10:05:03
Tert-butyl 2-amino-4-tert-butyl-1,3-thiazole-5-carboxylate structure
|
Common Name | Tert-butyl 2-amino-4-tert-butyl-1,3-thiazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2248357-72-2 | Molecular Weight | 256.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tert-butyl 2-amino-4-tert-butyl-1,3-thiazole-5-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H20N2O2S |
|---|---|
| Molecular Weight | 256.37 |
| InChIKey | JRHBPXWPUHDPCB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1sc(N)nc1C(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Tert-butyl 2-amino-4-tert-butyl-1,3-thiazole-5-carboxylate? |
| A: The English name of Tert-butyl 2-amino-4-tert-butyl-1,3-thiazole-5-carboxylate is Tert-butyl 2-amino-4-tert-butyl-1,3-thiazole-5-carboxylate. |
| Q: What is the InChIKey of Tert-butyl 2-amino-4-tert-butyl-1,3-thiazole-5-carboxylate? |
| A: InChIKey of Tert-butyl 2-amino-4-tert-butyl-1,3-thiazole-5-carboxylate is JRHBPXWPUHDPCB-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Tert-butyl 2-amino-4-tert-butyl-1,3-thiazole-5-carboxylate? |
| A: SMILES notation of Tert-butyl 2-amino-4-tert-butyl-1,3-thiazole-5-carboxylate is CC(C)(C)OC(=O)c1sc(N)nc1C(C)(C)C. |
| Q: What is the Chinese name of 2248357-72-2? |
| A: Chinese name of 2248357-72-2 is 2248357-72-2. |
| Q: What is the CAS number of Tert-butyl 2-amino-4-tert-butyl-1,3-thiazole-5-carboxylate? |
| A: CAS number of Tert-butyl 2-amino-4-tert-butyl-1,3-thiazole-5-carboxylate is 2248357-72-2. |
| Q: What is the molecular weight of Tert-butyl 2-amino-4-tert-butyl-1,3-thiazole-5-carboxylate? |
| A: Molecular weight of Tert-butyl 2-amino-4-tert-butyl-1,3-thiazole-5-carboxylate is 256.37. |
| Q: What is the molecular formula of Tert-butyl 2-amino-4-tert-butyl-1,3-thiazole-5-carboxylate? |
| A: Molecular formula of Tert-butyl 2-amino-4-tert-butyl-1,3-thiazole-5-carboxylate is C12H20N2O2S. |