Tert-butyl 4-amino-3,5-difluorobenzoate
Modify Date: 2026-07-24 22:12:20
Tert-butyl 4-amino-3,5-difluorobenzoate structure
|
Common Name | Tert-butyl 4-amino-3,5-difluorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 2248357-95-9 | Molecular Weight | 229.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13F2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tert-butyl 4-amino-3,5-difluorobenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13F2NO2 |
|---|---|
| Molecular Weight | 229.22 |
| InChIKey | XBQIGWPVTTUGBC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1cc(F)c(N)c(F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Tert-butyl 4-amino-3,5-difluorobenzoate? |
| A: SMILES notation of Tert-butyl 4-amino-3,5-difluorobenzoate is CC(C)(C)OC(=O)c1cc(F)c(N)c(F)c1. |
| Q: What is the molecular formula of Tert-butyl 4-amino-3,5-difluorobenzoate? |
| A: Molecular formula of Tert-butyl 4-amino-3,5-difluorobenzoate is C11H13F2NO2. |
| Q: What is the CAS number of Tert-butyl 4-amino-3,5-difluorobenzoate? |
| A: CAS number of Tert-butyl 4-amino-3,5-difluorobenzoate is 2248357-95-9. |
| Q: What is the English name of Tert-butyl 4-amino-3,5-difluorobenzoate? |
| A: The English name of Tert-butyl 4-amino-3,5-difluorobenzoate is Tert-butyl 4-amino-3,5-difluorobenzoate. |
| Q: What is the molecular weight of Tert-butyl 4-amino-3,5-difluorobenzoate? |
| A: Molecular weight of Tert-butyl 4-amino-3,5-difluorobenzoate is 229.22. |
| Q: What is the Chinese name of 2248357-95-9? |
| A: Chinese name of 2248357-95-9 is 2248357-95-9. |
| Q: What is the InChIKey of Tert-butyl 4-amino-3,5-difluorobenzoate? |
| A: InChIKey of Tert-butyl 4-amino-3,5-difluorobenzoate is XBQIGWPVTTUGBC-UHFFFAOYSA-N. |