rac-1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 2-methyl (1R,2R)-3,3-difluorocyclopropane-1,2-dicarboxylate
Modify Date: 2026-07-06 23:28:07
rac-1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 2-methyl (1R,2R)-3,3-difluorocyclopropane-1,2-dicarboxylate structure
|
Common Name | rac-1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 2-methyl (1R,2R)-3,3-difluorocyclopropane-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 2248368-81-0 | Molecular Weight | 325.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9F2NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rac-1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 2-methyl (1R,2R)-3,3-difluorocyclopropane-1,2-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H9F2NO6 |
|---|---|
| Molecular Weight | 325.22 |
| InChIKey | ZWVOOTAPFLBGJR-IUCAKERBSA-N |
| SMILES | COC(=O)C1C(C(=O)ON2C(=O)c3ccccc3C2=O)C1(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of rac-1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 2-methyl (1R,2R)-3,3-difluorocyclopropane-1,2-dicarboxylate? |
| A: The English name of rac-1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 2-methyl (1R,2R)-3,3-difluorocyclopropane-1,2-dicarboxylate is rac-1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 2-methyl (1R,2R)-3,3-difluorocyclopropane-1,2-dicarboxylate. |
| Q: What is the CAS number of rac-1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 2-methyl (1R,2R)-3,3-difluorocyclopropane-1,2-dicarboxylate? |
| A: CAS number of rac-1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 2-methyl (1R,2R)-3,3-difluorocyclopropane-1,2-dicarboxylate is 2248368-81-0. |
| Q: What is the molecular weight of rac-1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 2-methyl (1R,2R)-3,3-difluorocyclopropane-1,2-dicarboxylate? |
| A: Molecular weight of rac-1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 2-methyl (1R,2R)-3,3-difluorocyclopropane-1,2-dicarboxylate is 325.22. |
| Q: What is the Chinese name of 2248368-81-0? |
| A: Chinese name of 2248368-81-0 is 2248368-81-0. |
| Q: What is the InChIKey of rac-1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 2-methyl (1R,2R)-3,3-difluorocyclopropane-1,2-dicarboxylate? |
| A: InChIKey of rac-1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 2-methyl (1R,2R)-3,3-difluorocyclopropane-1,2-dicarboxylate is ZWVOOTAPFLBGJR-IUCAKERBSA-N. |
| Q: What is the molecular formula of rac-1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 2-methyl (1R,2R)-3,3-difluorocyclopropane-1,2-dicarboxylate? |
| A: Molecular formula of rac-1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 2-methyl (1R,2R)-3,3-difluorocyclopropane-1,2-dicarboxylate is C14H9F2NO6. |
| Q: What is the SMILES notation of rac-1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 2-methyl (1R,2R)-3,3-difluorocyclopropane-1,2-dicarboxylate? |
| A: SMILES notation of rac-1-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 2-methyl (1R,2R)-3,3-difluorocyclopropane-1,2-dicarboxylate is COC(=O)C1C(C(=O)ON2C(=O)c3ccccc3C2=O)C1(F)F. |