4-(1,3-Dioxolan-2-yl)-5-formyl-1,3-thiazole-2-carboxylic acid
Modify Date: 2026-07-09 19:41:21
4-(1,3-Dioxolan-2-yl)-5-formyl-1,3-thiazole-2-carboxylic acid structure
|
Common Name | 4-(1,3-Dioxolan-2-yl)-5-formyl-1,3-thiazole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2248388-93-2 | Molecular Weight | 229.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(1,3-Dioxolan-2-yl)-5-formyl-1,3-thiazole-2-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H7NO5S |
|---|---|
| Molecular Weight | 229.21 |
| InChIKey | RVNMCFFARZOXFM-UHFFFAOYSA-N |
| SMILES | O=Cc1sc(C(=O)O)nc1C1OCCO1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2248388-93-2? |
| A: Chinese name of 2248388-93-2 is 2248388-93-2. |
| Q: What is the InChIKey of 4-(1,3-Dioxolan-2-yl)-5-formyl-1,3-thiazole-2-carboxylic acid? |
| A: InChIKey of 4-(1,3-Dioxolan-2-yl)-5-formyl-1,3-thiazole-2-carboxylic acid is RVNMCFFARZOXFM-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-(1,3-Dioxolan-2-yl)-5-formyl-1,3-thiazole-2-carboxylic acid? |
| A: CAS number of 4-(1,3-Dioxolan-2-yl)-5-formyl-1,3-thiazole-2-carboxylic acid is 2248388-93-2. |
| Q: What is the English name of 4-(1,3-Dioxolan-2-yl)-5-formyl-1,3-thiazole-2-carboxylic acid? |
| A: The English name of 4-(1,3-Dioxolan-2-yl)-5-formyl-1,3-thiazole-2-carboxylic acid is 4-(1,3-Dioxolan-2-yl)-5-formyl-1,3-thiazole-2-carboxylic acid. |
| Q: What is the molecular weight of 4-(1,3-Dioxolan-2-yl)-5-formyl-1,3-thiazole-2-carboxylic acid? |
| A: Molecular weight of 4-(1,3-Dioxolan-2-yl)-5-formyl-1,3-thiazole-2-carboxylic acid is 229.21. |
| Q: What is the molecular formula of 4-(1,3-Dioxolan-2-yl)-5-formyl-1,3-thiazole-2-carboxylic acid? |
| A: Molecular formula of 4-(1,3-Dioxolan-2-yl)-5-formyl-1,3-thiazole-2-carboxylic acid is C8H7NO5S. |
| Q: What is the SMILES notation of 4-(1,3-Dioxolan-2-yl)-5-formyl-1,3-thiazole-2-carboxylic acid? |
| A: SMILES notation of 4-(1,3-Dioxolan-2-yl)-5-formyl-1,3-thiazole-2-carboxylic acid is O=Cc1sc(C(=O)O)nc1C1OCCO1. |