1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2,2,4,4-tetramethylpentanoate
Modify Date: 2025-09-09 17:42:06
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2,2,4,4-tetramethylpentanoate structure
|
Common Name | 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2,2,4,4-tetramethylpentanoate | ||
|---|---|---|---|---|
| CAS Number | 2248413-82-1 | Molecular Weight | 303.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2,2,4,4-tetramethylpentanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H21NO4 |
|---|---|
| Molecular Weight | 303.35 |
| InChIKey | STCGGUUJEJNVOE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)C(=O)ON1C(=O)c2ccccc2C1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2,2,4,4-tetramethylpentanoate? |
| A: Molecular weight of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2,2,4,4-tetramethylpentanoate is 303.35. |
| Q: What is the molecular formula of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2,2,4,4-tetramethylpentanoate? |
| A: Molecular formula of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2,2,4,4-tetramethylpentanoate is C17H21NO4. |
| Q: What is the CAS number of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2,2,4,4-tetramethylpentanoate? |
| A: CAS number of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2,2,4,4-tetramethylpentanoate is 2248413-82-1. |
| Q: What is the English name of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2,2,4,4-tetramethylpentanoate? |
| A: The English name of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2,2,4,4-tetramethylpentanoate is 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2,2,4,4-tetramethylpentanoate. |
| Q: What is the Chinese name of 2248413-82-1? |
| A: Chinese name of 2248413-82-1 is 2248413-82-1. |
| Q: What is the InChIKey of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2,2,4,4-tetramethylpentanoate? |
| A: InChIKey of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2,2,4,4-tetramethylpentanoate is STCGGUUJEJNVOE-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2,2,4,4-tetramethylpentanoate? |
| A: SMILES notation of 1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 2,2,4,4-tetramethylpentanoate is CC(C)(C)CC(C)(C)C(=O)ON1C(=O)c2ccccc2C1=O. |