Fmoc-L-Lys(Mtt-Aoa)-OH
Modify Date: 2026-07-21 17:20:58
Fmoc-L-Lys(Mtt-Aoa)-OH structure
|
Common Name | Fmoc-L-Lys(Mtt-Aoa)-OH | ||
|---|---|---|---|---|
| CAS Number | 2250436-45-2 | Molecular Weight | 697.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C43H43N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Fmoc-L-Lys(Mtt-Aoa)-OH |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C43H43N3O6 |
|---|---|
| Molecular Weight | 697.8 |
| InChIKey | MXFGFNWMKGWAOS-KDXMTYKHSA-N |
| SMILES | Cc1ccc(C(NOCC(=O)NCCCCC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)(c2ccccc2)c2ccccc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2250436-45-2? |
| A: Chinese name of 2250436-45-2 is 2250436-45-2. |
| Q: What is the CAS number of Fmoc-L-Lys(Mtt-Aoa)-OH? |
| A: CAS number of Fmoc-L-Lys(Mtt-Aoa)-OH is 2250436-45-2. |
| Q: What is the SMILES notation of Fmoc-L-Lys(Mtt-Aoa)-OH? |
| A: SMILES notation of Fmoc-L-Lys(Mtt-Aoa)-OH is Cc1ccc(C(NOCC(=O)NCCCCC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)(c2ccccc2)c2ccccc2)cc1. |
| Q: What is the molecular weight of Fmoc-L-Lys(Mtt-Aoa)-OH? |
| A: Molecular weight of Fmoc-L-Lys(Mtt-Aoa)-OH is 697.8. |
| Q: What is the English name of Fmoc-L-Lys(Mtt-Aoa)-OH? |
| A: The English name of Fmoc-L-Lys(Mtt-Aoa)-OH is Fmoc-L-Lys(Mtt-Aoa)-OH. |
| Q: What is the molecular formula of Fmoc-L-Lys(Mtt-Aoa)-OH? |
| A: Molecular formula of Fmoc-L-Lys(Mtt-Aoa)-OH is C43H43N3O6. |
| Q: What is the InChIKey of Fmoc-L-Lys(Mtt-Aoa)-OH? |
| A: InChIKey of Fmoc-L-Lys(Mtt-Aoa)-OH is MXFGFNWMKGWAOS-KDXMTYKHSA-N. |