Benzene,1,2,4-trichloro-5-(2,4-dinitrophenoxy)- structure
|
Common Name | Benzene,1,2,4-trichloro-5-(2,4-dinitrophenoxy)- | ||
|---|---|---|---|---|
| CAS Number | 22532-82-7 | Molecular Weight | 363.53700 | |
| Density | 1.655g/cm3 | Boiling Point | 424ºC at 760mmHg | |
| Molecular Formula | C12H5Cl3N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.2ºC | |
| Name | 1,2,4-trichloro-5-(2,4-dinitrophenoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.655g/cm3 |
|---|---|
| Boiling Point | 424ºC at 760mmHg |
| Molecular Formula | C12H5Cl3N2O5 |
| Molecular Weight | 363.53700 |
| Flash Point | 210.2ºC |
| Exact Mass | 361.92600 |
| PSA | 100.87000 |
| LogP | 6.30190 |
| Vapour Pressure | 5.29E-07mmHg at 25°C |
| Index of Refraction | 1.654 |
| InChIKey | NCUUHDKFGVNRCZ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Oc2cc(Cl)c(Cl)cc2Cl)c([N+](=O)[O-])c1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Ether,2,4-dinitrophenyl 2,4,5-trichlorophenyl |