4-Chloro-1-(2-chlorophenoxy)-2-nitrobenzene structure
|
Common Name | 4-Chloro-1-(2-chlorophenoxy)-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 22544-02-1 | Molecular Weight | 284.09500 | |
| Density | 1.451g/cm3 | Boiling Point | 346.9ºC at 760mmHg | |
| Molecular Formula | C12H7Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.6ºC | |
| Name | 4-chloro-1-(2-chlorophenoxy)-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.451g/cm3 |
|---|---|
| Boiling Point | 346.9ºC at 760mmHg |
| Molecular Formula | C12H7Cl2NO3 |
| Molecular Weight | 284.09500 |
| Flash Point | 163.6ºC |
| Exact Mass | 282.98000 |
| PSA | 55.05000 |
| LogP | 5.21710 |
| Vapour Pressure | 0.000112mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | AXWRVQCZOCJLFC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1Oc1ccccc1Cl |
| HS Code | 2909309090 |
|---|
|
~%
4-Chloro-1-(2-c... CAS#:22544-02-1 |
| Literature: Nippon Kagaku Zasshi, , vol. 75, p. 399 Chem.Abstr., , p. 11300 Pr. Irish Acad., , vol. 53 B, p. 61,66, 82 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| o-Chlorophenyl 4-chloro-2-nitrophenyl ether |
| 2-Nitro-2',4-dichloro-diphenyl ether |