Ethanethioic acid, anhydrosulfide with diphenylphosphinodithioic acid structure
|
Common Name | Ethanethioic acid, anhydrosulfide with diphenylphosphinodithioic acid | ||
|---|---|---|---|---|
| CAS Number | 22551-32-2 | Molecular Weight | 292.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13OPS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethanethioic acid, anhydrosulfide with diphenylphosphinodithioic acid |
|---|
| Molecular Formula | C14H13OPS2 |
|---|---|
| Molecular Weight | 292.4 |
| InChIKey | CXLJZCMTNVOKJL-UHFFFAOYSA-N |
| SMILES | CC(=O)SP(=S)(c1ccccc1)c1ccccc1 |