Codactide
Modify Date: 2025-08-25 08:09:41
Codactide structure
|
Common Name | Codactide | ||
|---|---|---|---|---|
| CAS Number | 22572-04-9 | Molecular Weight | 2192.59000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C101H158N30O23S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CodactideCodactide is a synthetic octadecapeptide, with corticotropin-like action[1]. |
| Name | Codactidum |
|---|---|
| Synonym | More Synonyms |
| Description | Codactide is a synthetic octadecapeptide, with corticotropin-like action[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C101H158N30O23S |
|---|---|
| Molecular Weight | 2192.59000 |
| Exact Mass | 2191.18000 |
| PSA | 914.78000 |
| LogP | 5.14250 |
| InChIKey | KXHVGPOWQPPVFU-QQLGXXNZSA-N |
| SMILES | CSCCC(NC(=O)C(CO)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(N)CO)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCNC(=N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCC(=O)NC(CCCCN)C(=O)N1CCCC1C(=O)NC(C(=O)NCC(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(N)=O)C(C)C |
| Codactida [INN-Spanish] |
| D-Ser-Tyr-Ser-Met-Glu-His-Phe-Arg-Trp-Gly-Lys-Pro-Val-Gly-Lys-Lys-Lys-Lys-NH2 |
| D-Ser(1),lys(17),lys(18)corticotropin-(1-18) octadecapeptide amide |
| Codactida |