9-Methyl-5-oxa-13-azadispiro[3.1.6^{6}.3^{4}]pentadecane
Modify Date: 2026-08-03 17:34:34
![9-Methyl-5-oxa-13-azadispiro[3.1.6^{6}.3^{4}]pentadecane Structure](https://www.chemsrc.com/extcaspic/483/2260930-65-0.png)
9-Methyl-5-oxa-13-azadispiro[3.1.6^{6}.3^{4}]pentadecane structure
|
Common Name | 9-Methyl-5-oxa-13-azadispiro[3.1.6^{6}.3^{4}]pentadecane | ||
|---|---|---|---|---|
| CAS Number | 2260930-65-0 | Molecular Weight | 223.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9-Methyl-5-oxa-13-azadispiro[3.1.6^{6}.3^{4}]pentadecane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H25NO |
|---|---|
| Molecular Weight | 223.35 |
| InChIKey | RTHNNTMHXXWVOW-UHFFFAOYSA-N |
| SMILES | CC1CCCC2(CC1)NCCC1(CCC1)O2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 9-Methyl-5-oxa-13-azadispiro[3.1.6^{6}.3^{4}]pentadecane? |
| A: Molecular formula of 9-Methyl-5-oxa-13-azadispiro[3.1.6^{6}.3^{4}]pentadecane is C14H25NO. |
| Q: What is the molecular weight of 9-Methyl-5-oxa-13-azadispiro[3.1.6^{6}.3^{4}]pentadecane? |
| A: Molecular weight of 9-Methyl-5-oxa-13-azadispiro[3.1.6^{6}.3^{4}]pentadecane is 223.35. |
| Q: What is the InChIKey of 9-Methyl-5-oxa-13-azadispiro[3.1.6^{6}.3^{4}]pentadecane? |
| A: InChIKey of 9-Methyl-5-oxa-13-azadispiro[3.1.6^{6}.3^{4}]pentadecane is RTHNNTMHXXWVOW-UHFFFAOYSA-N. |
| Q: What is the English name of 9-Methyl-5-oxa-13-azadispiro[3.1.6^{6}.3^{4}]pentadecane? |
| A: The English name of 9-Methyl-5-oxa-13-azadispiro[3.1.6^{6}.3^{4}]pentadecane is 9-Methyl-5-oxa-13-azadispiro[3.1.6^{6}.3^{4}]pentadecane. |
| Q: What is the CAS number of 9-Methyl-5-oxa-13-azadispiro[3.1.6^{6}.3^{4}]pentadecane? |
| A: CAS number of 9-Methyl-5-oxa-13-azadispiro[3.1.6^{6}.3^{4}]pentadecane is 2260930-65-0. |
| Q: What is the Chinese name of 2260930-65-0? |
| A: Chinese name of 2260930-65-0 is 2260930-65-0. |
| Q: What is the SMILES notation of 9-Methyl-5-oxa-13-azadispiro[3.1.6^{6}.3^{4}]pentadecane? |
| A: SMILES notation of 9-Methyl-5-oxa-13-azadispiro[3.1.6^{6}.3^{4}]pentadecane is CC1CCCC2(CC1)NCCC1(CCC1)O2. |