1'-methyl-[1,3'-Biazetidine]-3-sulfonamide
Modify Date: 2026-08-22 07:11:27
![1'-methyl-[1,3'-Biazetidine]-3-sulfonamide Structure](https://www.chemsrc.com/extcaspic/031/2260973-83-7.png)
1'-methyl-[1,3'-Biazetidine]-3-sulfonamide structure
|
Common Name | 1'-methyl-[1,3'-Biazetidine]-3-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 2260973-83-7 | Molecular Weight | 205.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H15N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1'-methyl-[1,3'-Biazetidine]-3-sulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H15N3O2S |
|---|---|
| Molecular Weight | 205.28 |
| InChIKey | BSWBECZHXAHHIL-UHFFFAOYSA-N |
| SMILES | CN1CC(N2CC(S(N)(=O)=O)C2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1'-methyl-[1,3'-Biazetidine]-3-sulfonamide? |
| A: Molecular weight of 1'-methyl-[1,3'-Biazetidine]-3-sulfonamide is 205.28. |
| Q: What is the SMILES notation of 1'-methyl-[1,3'-Biazetidine]-3-sulfonamide? |
| A: SMILES notation of 1'-methyl-[1,3'-Biazetidine]-3-sulfonamide is CN1CC(N2CC(S(N)(=O)=O)C2)C1. |
| Q: What is the CAS number of 1'-methyl-[1,3'-Biazetidine]-3-sulfonamide? |
| A: CAS number of 1'-methyl-[1,3'-Biazetidine]-3-sulfonamide is 2260973-83-7. |
| Q: What is the InChIKey of 1'-methyl-[1,3'-Biazetidine]-3-sulfonamide? |
| A: InChIKey of 1'-methyl-[1,3'-Biazetidine]-3-sulfonamide is BSWBECZHXAHHIL-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1'-methyl-[1,3'-Biazetidine]-3-sulfonamide? |
| A: Molecular formula of 1'-methyl-[1,3'-Biazetidine]-3-sulfonamide is C7H15N3O2S. |
| Q: What is the English name of 1'-methyl-[1,3'-Biazetidine]-3-sulfonamide? |
| A: The English name of 1'-methyl-[1,3'-Biazetidine]-3-sulfonamide is 1'-methyl-[1,3'-Biazetidine]-3-sulfonamide. |
| Q: What is the Chinese name of 2260973-83-7? |
| A: Chinese name of 2260973-83-7 is 2260973-83-7. |