Cycloheptanone,2-phenyl-, 2-(2,4-dinitrophenyl)hydrazone structure
|
Common Name | Cycloheptanone,2-phenyl-, 2-(2,4-dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 22612-82-4 | Molecular Weight | 368.38700 | |
| Density | 1.34g/cm3 | Boiling Point | 536.4ºC at 760 mmHg | |
| Molecular Formula | C19H20N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.2ºC | |
| Name | 2,4-dinitro-N-[(E)-(2-phenylcycloheptylidene)amino]aniline |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 536.4ºC at 760 mmHg |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.38700 |
| Flash Point | 278.2ºC |
| Exact Mass | 368.14800 |
| PSA | 116.03000 |
| LogP | 6.13820 |
| Vapour Pressure | 1.41E-11mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | IHRPWSXWLYWEMJ-LVZFUZTISA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=C2CCCCCC2c2ccccc2)c([N+](=O)[O-])c1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |