2-Acetyloxy-3-nitrobenzoic acid methyl ester structure
|
Common Name | 2-Acetyloxy-3-nitrobenzoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 22621-42-7 | Molecular Weight | 239.18200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-acetyloxy-3-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9NO6 |
|---|---|
| Molecular Weight | 239.18200 |
| Exact Mass | 239.04300 |
| PSA | 98.42000 |
| LogP | 1.82990 |
| InChIKey | WGKSBSULRFMNQF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc([N+](=O)[O-])c1OC(C)=O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Salicylic acid,3-nitro-,methyl ester,acetate (ester) |
| Methyl 2-(acetyloxy)-3-nitrobenzoate |
| 2-Acetyloxy-3-nitrobenzoic acid methyl ester |