N-butylheptadecafluoro-N-(2-hydroxyethyl)octanesulphonamide structure
|
Common Name | N-butylheptadecafluoro-N-(2-hydroxyethyl)octanesulphonamide | ||
|---|---|---|---|---|
| CAS Number | 2263-09-4 | Molecular Weight | 599.30400 | |
| Density | 1.583g/cm3 | Boiling Point | 349.2ºC at 760mmHg | |
| Molecular Formula | C14H14F17NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165ºC | |
| Name | N-butyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluoro-N-(2-hydroxyethyl)octane-1-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.583g/cm3 |
|---|---|
| Boiling Point | 349.2ºC at 760mmHg |
| Molecular Formula | C14H14F17NO3S |
| Molecular Weight | 599.30400 |
| Flash Point | 165ºC |
| Exact Mass | 599.04200 |
| PSA | 65.99000 |
| LogP | 6.45830 |
| Vapour Pressure | 2.9E-06mmHg at 25°C |
| Index of Refraction | 1.358 |
| InChIKey | AQWROZBAYZBWIH-UHFFFAOYSA-N |
| SMILES | CCCCN(CCO)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|
~%
N-butylheptadec... CAS#:2263-09-4 |
| Literature: Minnesota Mining and Mfg.Co. Patent: US2803656 , 1956 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| EINECS 218-864-4 |
| N-Butyl-N-ethanol-perfluoroctansulfonamid |