2H-1,4-Benzothiazine-2-aceticacid, 3,4-dihydro-3-oxo-, 2-(4-fluorophenyl)hydrazide
Modify Date: 2025-09-12 18:08:51
2H-1,4-Benzothiazine-2-aceticacid, 3,4-dihydro-3-oxo-, 2-(4-fluorophenyl)hydrazide structure
|
Common Name | 2H-1,4-Benzothiazine-2-aceticacid, 3,4-dihydro-3-oxo-, 2-(4-fluorophenyl)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 2263-58-3 | Molecular Weight | 331.36500 | |
| Density | 1.381g/cm3 | Boiling Point | 514.6ºC at 760mmHg | |
| Molecular Formula | C16H14FN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265ºC | |
| Name | (3-Oxo-3,4-dihydro-2H-benzo[1,4]thiazin-2-yl)-essigsaeure-[N'-(4-fluor-phenyl)-hydrazid] |
|---|---|
| Synonym | More Synonyms |
| Density | 1.381g/cm3 |
|---|---|
| Boiling Point | 514.6ºC at 760mmHg |
| Molecular Formula | C16H14FN3O2S |
| Molecular Weight | 331.36500 |
| Flash Point | 265ºC |
| Exact Mass | 331.07900 |
| PSA | 95.53000 |
| LogP | 3.37380 |
| Vapour Pressure | 1.06E-10mmHg at 25°C |
| Index of Refraction | 1.65 |
|
~%
2H-1,4-Benzothi... CAS#:2263-58-3 |
| Literature: Kirchner; Alexander Journal of the American Chemical Society, 1959 , vol. 81, p. 1721,1722 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (3-oxo-3,4-dihydro-2H-benzo[1,4]thiazin-2-yl)-acetic acid-(3-chloro-anilide) |
| N-(2-Chlorophenyl)-3-oxo-3,4-dihydro-2H-1,4-benzothiazine-2-acetamide |
| (3-oxo-3,4-dihydro-2H-benzo[1,4]thiazin-2-yl)-acetic acid-[N'-(4-fluoro-phenyl)-hydrazide] |
| (3-Oxo-3,4-dihydro-2H-benzo[1,4]thiazin-2-yl)-essigsaeure-(3-chlor-anilid) |
| 2H-1,4-Benzothiazine-2-acetamide,3,4-dihydro-N-(2-chlorophenyl)-3-oxo |
| N-(3-chlorophenyl)-2-(3-oxo-1,4-benzothiazin-2-yl) acetamide |