3,5-Bis(trifluoromethyl)cyclohexanamine HCl
Modify Date: 2025-09-09 20:13:42
3,5-Bis(trifluoromethyl)cyclohexanamine HCl structure
|
Common Name | 3,5-Bis(trifluoromethyl)cyclohexanamine HCl | ||
|---|---|---|---|---|
| CAS Number | 226548-45-4 | Molecular Weight | 271.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H12ClF6N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5-Bis(trifluoromethyl)cyclohexanamine HCl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H12ClF6N |
|---|---|
| Molecular Weight | 271.63 |
| InChIKey | ALBRWXRKTICYFK-UHFFFAOYSA-N |
| SMILES | Cl.NC1CC(C(F)(F)F)CC(C(F)(F)F)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3,5-Bis(trifluoromethyl)cyclohexanamine HCl? |
| A: InChIKey of 3,5-Bis(trifluoromethyl)cyclohexanamine HCl is ALBRWXRKTICYFK-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3,5-Bis(trifluoromethyl)cyclohexanamine HCl? |
| A: SMILES notation of 3,5-Bis(trifluoromethyl)cyclohexanamine HCl is Cl.NC1CC(C(F)(F)F)CC(C(F)(F)F)C1. |
| Q: What is the CAS number of 3,5-Bis(trifluoromethyl)cyclohexanamine HCl? |
| A: CAS number of 3,5-Bis(trifluoromethyl)cyclohexanamine HCl is 226548-45-4. |
| Q: What is the molecular formula of 3,5-Bis(trifluoromethyl)cyclohexanamine HCl? |
| A: Molecular formula of 3,5-Bis(trifluoromethyl)cyclohexanamine HCl is C8H12ClF6N. |
| Q: What is the English name of 3,5-Bis(trifluoromethyl)cyclohexanamine HCl? |
| A: The English name of 3,5-Bis(trifluoromethyl)cyclohexanamine HCl is 3,5-Bis(trifluoromethyl)cyclohexanamine HCl. |
| Q: What is the molecular weight of 3,5-Bis(trifluoromethyl)cyclohexanamine HCl? |
| A: Molecular weight of 3,5-Bis(trifluoromethyl)cyclohexanamine HCl is 271.63. |
| Q: What is the Chinese name of 226548-45-4? |
| A: Chinese name of 226548-45-4 is 226548-45-4. |