1-Indyl-2-Nitropropene structure
|
Common Name | 1-Indyl-2-Nitropropene | ||
|---|---|---|---|---|
| CAS Number | 22693-51-2 | Molecular Weight | 202.20900 | |
| Density | 1.3g/cm3 | Boiling Point | 402.2ºC at 760mmHg | |
| Molecular Formula | C11H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197ºC | |
| Name | 3-[(E)-2-nitroprop-1-enyl]-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 402.2ºC at 760mmHg |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.20900 |
| Flash Point | 197ºC |
| Exact Mass | 202.07400 |
| PSA | 61.61000 |
| LogP | 3.32860 |
| Vapour Pressure | 2.6E-06mmHg at 25°C |
| Index of Refraction | 1.703 |
| InChIKey | BPAQTDYDNBMYAM-SOFGYWHQSA-N |
| SMILES | CC(=Cc1c[nH]c2ccccc12)[N+](=O)[O-] |
|
~66%
1-Indyl-2-Nitro... CAS#:22693-51-2 |
| Literature: Journal of Medicinal Chemistry, , vol. 54, # 20 p. 7422 - 7426 |
| 1-Indyl-2-Nitropropene |