1H-Isoindole-1,3(2H)-dione,2-(2-chlorophenyl) structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione,2-(2-chlorophenyl) | ||
|---|---|---|---|---|
| CAS Number | 22698-95-9 | Molecular Weight | 257.67200 | |
| Density | 1.441g/cm3 | Boiling Point | 414.9ºC at 760mmHg | |
| Molecular Formula | C14H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.7ºC | |
| Name | n-(2-chlorophenyl)phthalimide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.441g/cm3 |
|---|---|
| Boiling Point | 414.9ºC at 760mmHg |
| Molecular Formula | C14H8ClNO2 |
| Molecular Weight | 257.67200 |
| Flash Point | 204.7ºC |
| Exact Mass | 257.02400 |
| PSA | 37.38000 |
| LogP | 3.20560 |
| Vapour Pressure | 4.29E-07mmHg at 25°C |
| Index of Refraction | 1.672 |
| InChIKey | HZJTXHXNUXBSFD-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccccc1Cl |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| phthalimido-2-chlorobenzene |