3-[4-[(3-amino-2,4,6-triiodo-benzoyl)amino]phenyl]propanoic acid structure
|
Common Name | 3-[4-[(3-amino-2,4,6-triiodo-benzoyl)amino]phenyl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 22708-48-1 | Molecular Weight | 661.99900 | |
| Density | 2.357g/cm3 | Boiling Point | 616.2ºC at 760mmHg | |
| Molecular Formula | C16H13I3N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 326.5ºC | |
| Name | 3-[4-[(3-amino-2,4,6-triiodobenzoyl)amino]phenyl]propanoic acid |
|---|
| Density | 2.357g/cm3 |
|---|---|
| Boiling Point | 616.2ºC at 760mmHg |
| Molecular Formula | C16H13I3N2O3 |
| Molecular Weight | 661.99900 |
| Flash Point | 326.5ºC |
| Exact Mass | 661.80600 |
| PSA | 92.42000 |
| LogP | 5.00630 |
| Vapour Pressure | 4.83E-16mmHg at 25°C |
| Index of Refraction | 1.795 |
| InChIKey | MFJHJTQAGFREML-UHFFFAOYSA-N |
| SMILES | Nc1c(I)cc(I)c(C(=O)Nc2ccc(CCC(=O)O)cc2)c1I |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |