rac-benzyl (3R,4R)-3,4-bis(hydroxymethyl)pyrrolidine-1-carboxylate
Modify Date: 2025-09-01 16:05:19
rac-benzyl (3R,4R)-3,4-bis(hydroxymethyl)pyrrolidine-1-carboxylate structure
|
Common Name | rac-benzyl (3R,4R)-3,4-bis(hydroxymethyl)pyrrolidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2271663-83-1 | Molecular Weight | 265.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rac-benzyl (3R,4R)-3,4-bis(hydroxymethyl)pyrrolidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H19NO4 |
|---|---|
| Molecular Weight | 265.30 |
| InChIKey | REDMGWHSUADHFO-STQMWFEESA-N |
| SMILES | O=C(OCc1ccccc1)N1CC(CO)C(CO)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of rac-benzyl (3R,4R)-3,4-bis(hydroxymethyl)pyrrolidine-1-carboxylate? |
| A: InChIKey of rac-benzyl (3R,4R)-3,4-bis(hydroxymethyl)pyrrolidine-1-carboxylate is REDMGWHSUADHFO-STQMWFEESA-N. |
| Q: What is the SMILES notation of rac-benzyl (3R,4R)-3,4-bis(hydroxymethyl)pyrrolidine-1-carboxylate? |
| A: SMILES notation of rac-benzyl (3R,4R)-3,4-bis(hydroxymethyl)pyrrolidine-1-carboxylate is O=C(OCc1ccccc1)N1CC(CO)C(CO)C1. |
| Q: What is the molecular weight of rac-benzyl (3R,4R)-3,4-bis(hydroxymethyl)pyrrolidine-1-carboxylate? |
| A: Molecular weight of rac-benzyl (3R,4R)-3,4-bis(hydroxymethyl)pyrrolidine-1-carboxylate is 265.30. |
| Q: What is the English name of rac-benzyl (3R,4R)-3,4-bis(hydroxymethyl)pyrrolidine-1-carboxylate? |
| A: The English name of rac-benzyl (3R,4R)-3,4-bis(hydroxymethyl)pyrrolidine-1-carboxylate is rac-benzyl (3R,4R)-3,4-bis(hydroxymethyl)pyrrolidine-1-carboxylate. |
| Q: What is the Chinese name of 2271663-83-1? |
| A: Chinese name of 2271663-83-1 is 2271663-83-1. |
| Q: What is the molecular formula of rac-benzyl (3R,4R)-3,4-bis(hydroxymethyl)pyrrolidine-1-carboxylate? |
| A: Molecular formula of rac-benzyl (3R,4R)-3,4-bis(hydroxymethyl)pyrrolidine-1-carboxylate is C14H19NO4. |
| Q: What is the CAS number of rac-benzyl (3R,4R)-3,4-bis(hydroxymethyl)pyrrolidine-1-carboxylate? |
| A: CAS number of rac-benzyl (3R,4R)-3,4-bis(hydroxymethyl)pyrrolidine-1-carboxylate is 2271663-83-1. |