Ethyl 4-hydroxy-2-(4-(trifluoromethyl)phenyl)thiazole-5-carboxylate structure
|
Common Name | Ethyl 4-hydroxy-2-(4-(trifluoromethyl)phenyl)thiazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 227199-08-8 | Molecular Weight | 317.28400 | |
| Density | 1.417g/cm3 | Boiling Point | 388.3ºC at 760mmHg | |
| Molecular Formula | C13H10F3NO3S | Melting Point | 121-123ºC | |
| MSDS | N/A | Flash Point | 188.6ºC | |
| Name | Ethyl 4-hydroxy-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.417g/cm3 |
|---|---|
| Boiling Point | 388.3ºC at 760mmHg |
| Melting Point | 121-123ºC |
| Molecular Formula | C13H10F3NO3S |
| Molecular Weight | 317.28400 |
| Flash Point | 188.6ºC |
| Exact Mass | 317.03300 |
| PSA | 87.66000 |
| LogP | 3.71120 |
| Vapour Pressure | 1.39E-06mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | ZBBWVSQYLJQTIB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1sc(-c2ccc(C(F)(F)F)cc2)nc1O |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-[ethoxy(hydroxy)methylidene]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-one |