1,3,5-Triazine-2,4,6-triamine,N2,N4,N6-tris(2-chlorophenyl)- structure
|
Common Name | 1,3,5-Triazine-2,4,6-triamine,N2,N4,N6-tris(2-chlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 2272-28-8 | Molecular Weight | 457.74300 | |
| Density | 1.51g/cm3 | Boiling Point | 627.6ºC at 760mmHg | |
| Molecular Formula | C21H15Cl3N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 333.4ºC | |
| Name | 2-N,4-N,6-N-tris(2-chlorophenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 627.6ºC at 760mmHg |
| Molecular Formula | C21H15Cl3N6 |
| Molecular Weight | 457.74300 |
| Flash Point | 333.4ºC |
| Exact Mass | 456.04200 |
| PSA | 74.76000 |
| LogP | 7.28160 |
| Vapour Pressure | 1.15E-15mmHg at 25°C |
| Index of Refraction | 1.748 |
| InChIKey | BAUIBXDNTYQUAG-UHFFFAOYSA-N |
| SMILES | Clc1ccccc1Nc1nc(Nc2ccccc2Cl)nc(Nc2ccccc2Cl)n1 |
| HS Code | 2933699090 |
|---|
|
~96%
1,3,5-Triazine-... CAS#:2272-28-8 |
| Literature: Sha, Yaowu; Dong, Yuyi Synthetic Communications, 2003 , vol. 33, # 15 p. 2599 - 2604 |
|
~%
1,3,5-Triazine-... CAS#:2272-28-8 |
| Literature: v.Meyer,E.; Naebe Journal fuer Praktische Chemie (Leipzig), 1910 , vol. <2>82, p. 536 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 2,4,6-Tris-<2-chlor-anilino>-1,3,5-triazin |