4,6-dichloro-N-(2,5-dichlorophenyl)-1,3,5-triazin-2-amine structure
|
Common Name | 4,6-dichloro-N-(2,5-dichlorophenyl)-1,3,5-triazin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 2272-33-5 | Molecular Weight | 309.96700 | |
| Density | 1.694g/cm3 | Boiling Point | 477.7ºC at 760mmHg | |
| Molecular Formula | C9H4Cl4N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.7ºC | |
| Name | 4,6-dichloro-N-(2,5-dichlorophenyl)-1,3,5-triazin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.694g/cm3 |
|---|---|
| Boiling Point | 477.7ºC at 760mmHg |
| Molecular Formula | C9H4Cl4N4 |
| Molecular Weight | 309.96700 |
| Flash Point | 242.7ºC |
| Exact Mass | 307.91900 |
| PSA | 53.93000 |
| LogP | 3.65070 |
| Vapour Pressure | 2.74E-09mmHg at 25°C |
| Index of Refraction | 1.684 |
| InChIKey | MNIGQQIFJWVXOW-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Cl)c(Nc2nc(Cl)nc(Cl)n2)c1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 4,6-Dichlor-2-<2,5-dichlor-anilino>-<1,3,5>triazin |