2,11-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,10-diol structure
|
Common Name | 2,11-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,10-diol | ||
|---|---|---|---|---|
| CAS Number | 2273-24-7 | Molecular Weight | 327.37400 | |
| Density | 1.29g/cm3 | Boiling Point | 527.5ºC at 760 mmHg | |
| Molecular Formula | C19H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.9ºC | |
| Name | 2,11-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,10-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 527.5ºC at 760 mmHg |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.37400 |
| Flash Point | 272.9ºC |
| Exact Mass | 327.14700 |
| PSA | 62.16000 |
| LogP | 2.80500 |
| Vapour Pressure | 9.55E-12mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | LYQUWRCDPNGKKU-UHFFFAOYSA-N |
| SMILES | COc1cc2c3c(c1O)-c1c(ccc(O)c1OC)CC3N(C)CC2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Isocorytuberin |
| isocorytuberine |
| 1,10-Dihydroxy-2,11-dimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo<de,g>chinolin |