triphenyl(9H-xanthen-9-yl)phosphanium,perchlorate structure
|
Common Name | triphenyl(9H-xanthen-9-yl)phosphanium,perchlorate | ||
|---|---|---|---|---|
| CAS Number | 22730-67-2 | Molecular Weight | 542.94600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H24ClO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | triphenyl(9H-xanthen-9-yl)phosphanium,perchlorate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C31H24ClO5P |
|---|---|
| Molecular Weight | 542.94600 |
| Exact Mass | 542.10500 |
| PSA | 97.09000 |
| LogP | 7.09010 |
| InChIKey | JHLOGRQCBNFRFX-UHFFFAOYSA-M |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc([P+](c2ccccc2)(c2ccccc2)C2c3ccccc3Oc3ccccc32)cc1 |
|
~95%
triphenyl(9H-xa... CAS#:22730-67-2 |
| Literature: Reynolds, George A.; Chen, Chin H. Journal of Organic Chemistry, 1980 , vol. 45, # 12 p. 2458 - 2459 |
|
~%
triphenyl(9H-xa... CAS#:22730-67-2 |
| Literature: Handoo, Kishan L.; Kaul, Anju Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1988 , vol. 27, # 1-12 p. 1 - 2 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Triphenylphosphoniumxanthen-9-yl perchlorate |
| Phosphonium,triphenyl-9H-xanthen-9-yl-,perchlorate |