2-Naphthalenecarboxylicacid, 1,2,3,4-tetrahydro-4-oxo-, ethyl ester structure
|
Common Name | 2-Naphthalenecarboxylicacid, 1,2,3,4-tetrahydro-4-oxo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 22743-00-6 | Molecular Weight | 218.24800 | |
| Density | 1.167g/cm3 | Boiling Point | 332.7ºC at 760mmHg | |
| Molecular Formula | C13H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.1ºC | |
| Name | ethyl 4-oxo-2,3-dihydro-1H-naphthalene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 332.7ºC at 760mmHg |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.24800 |
| Flash Point | 146.1ºC |
| Exact Mass | 218.09400 |
| PSA | 43.37000 |
| LogP | 1.99480 |
| Vapour Pressure | 0.000143mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | CNCAIYXTLXJJQG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC(=O)c2ccccc2C1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-Naphthoic acid,2,3,4-tetrahydro-4-oxo-,ethyl ester |
| 5-ethoxycarbonyl-1,2-benzo-3-oxocyclohexenone |
| 4-Oxo-1,2,3,4-tetrahydro-[2]naphthoesaeure-aethylester |
| Ethyl 4-oxo-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
| 1,2,3,4-tetrahydro-4-oxo-2-naphthalenecarboxylic acid,ethyl ester |
| 4-oxo-1,2,3,4-tetrahydro-[2]naphthoic acid ethyl ester |
| ethyl 1,2,3,4-tetrahydro-4-oxo-2-naphthoate |