Acetic acid, diphenyl-, 8-ethyl-3alpha-nortropanyl ester, hydrochloride
Modify Date: 2026-07-24 20:03:07
Acetic acid, diphenyl-, 8-ethyl-3alpha-nortropanyl ester, hydrochloride structure
|
Common Name | Acetic acid, diphenyl-, 8-ethyl-3alpha-nortropanyl ester, hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2275-76-5 | Molecular Weight | 385.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H28ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Acetic acid, diphenyl-, 8-ethyl-3alpha-nortropanyl ester, hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H28ClNO2 |
|---|---|
| Molecular Weight | 385.9 |
| InChIKey | JHWAYHTWMCXGFC-ILOBMFFHSA-N |
| SMILES | CCN1C2CCC1CC(OC(=O)C(c1ccccc1)c1ccccc1)C2.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2275-76-5? |
| A: Chinese name of 2275-76-5 is 2275-76-5. |
| Q: What is the molecular weight of Acetic acid, diphenyl-, 8-ethyl-3alpha-nortropanyl ester, hydrochloride? |
| A: Molecular weight of Acetic acid, diphenyl-, 8-ethyl-3alpha-nortropanyl ester, hydrochloride is 385.9. |
| Q: What is the SMILES notation of Acetic acid, diphenyl-, 8-ethyl-3alpha-nortropanyl ester, hydrochloride? |
| A: SMILES notation of Acetic acid, diphenyl-, 8-ethyl-3alpha-nortropanyl ester, hydrochloride is CCN1C2CCC1CC(OC(=O)C(c1ccccc1)c1ccccc1)C2.Cl. |
| Q: What is the CAS number of Acetic acid, diphenyl-, 8-ethyl-3alpha-nortropanyl ester, hydrochloride? |
| A: CAS number of Acetic acid, diphenyl-, 8-ethyl-3alpha-nortropanyl ester, hydrochloride is 2275-76-5. |
| Q: What is the InChIKey of Acetic acid, diphenyl-, 8-ethyl-3alpha-nortropanyl ester, hydrochloride? |
| A: InChIKey of Acetic acid, diphenyl-, 8-ethyl-3alpha-nortropanyl ester, hydrochloride is JHWAYHTWMCXGFC-ILOBMFFHSA-N. |
| Q: What is the English name of Acetic acid, diphenyl-, 8-ethyl-3alpha-nortropanyl ester, hydrochloride? |
| A: The English name of Acetic acid, diphenyl-, 8-ethyl-3alpha-nortropanyl ester, hydrochloride is Acetic acid, diphenyl-, 8-ethyl-3alpha-nortropanyl ester, hydrochloride. |
| Q: What is the molecular formula of Acetic acid, diphenyl-, 8-ethyl-3alpha-nortropanyl ester, hydrochloride? |
| A: Molecular formula of Acetic acid, diphenyl-, 8-ethyl-3alpha-nortropanyl ester, hydrochloride is C23H28ClNO2. |