2-(3-Cyclobutoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Modify Date: 2026-09-15 20:11:33
2-(3-Cyclobutoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane structure
|
Common Name | 2-(3-Cyclobutoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | ||
|---|---|---|---|---|
| CAS Number | 2275606-47-6 | Molecular Weight | 274.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H23BO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3-Cyclobutoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H23BO3 |
|---|---|
| Molecular Weight | 274.2 |
| InChIKey | CUASHLMUXVQSLX-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2cccc(OC3CCC3)c2)OC1(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(3-Cyclobutoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: CAS number of 2-(3-Cyclobutoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is 2275606-47-6. |
| Q: What is the InChIKey of 2-(3-Cyclobutoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: InChIKey of 2-(3-Cyclobutoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is CUASHLMUXVQSLX-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-(3-Cyclobutoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: Molecular weight of 2-(3-Cyclobutoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is 274.2. |
| Q: What is the Chinese name of 2275606-47-6? |
| A: Chinese name of 2275606-47-6 is 2275606-47-6. |
| Q: What is the SMILES notation of 2-(3-Cyclobutoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: SMILES notation of 2-(3-Cyclobutoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is CC1(C)OB(c2cccc(OC3CCC3)c2)OC1(C)C. |
| Q: What is the molecular formula of 2-(3-Cyclobutoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: Molecular formula of 2-(3-Cyclobutoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is C16H23BO3. |
| Q: What is the English name of 2-(3-Cyclobutoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: The English name of 2-(3-Cyclobutoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is 2-(3-Cyclobutoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. |