Biotin-PEG11-CH2CH2N3
Modify Date: 2025-08-26 11:25:04
Biotin-PEG11-CH2CH2N3 structure
|
Common Name | Biotin-PEG11-CH2CH2N3 | ||
|---|---|---|---|---|
| CAS Number | 2276672-04-7 | Molecular Weight | 796.97 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H64N6O13S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Biotin-PEG11-CH2CH2N3Biotin-PEG11-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Biotin-PEG11-azide |
|---|
| Description | Biotin-PEG11-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C34H64N6O13S |
|---|---|
| Molecular Weight | 796.97 |
| InChIKey | WETRQYMCASPBIY-NPGLXDPKSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCCCC1SCC2NC(=O)NC21 |