6(5H)-Phenanthridinone,3,8-dichloro- structure
|
Common Name | 6(5H)-Phenanthridinone,3,8-dichloro- | ||
|---|---|---|---|---|
| CAS Number | 22771-43-3 | Molecular Weight | 264.10700 | |
| Density | 1.447g/cm3 | Boiling Point | 345.8ºC at 760mmHg | |
| Molecular Formula | C13H7Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163ºC | |
| Name | 3,8-dichloro-5H-phenanthridin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.447g/cm3 |
|---|---|
| Boiling Point | 345.8ºC at 760mmHg |
| Molecular Formula | C13H7Cl2NO |
| Molecular Weight | 264.10700 |
| Flash Point | 163ºC |
| Exact Mass | 262.99000 |
| PSA | 32.86000 |
| LogP | 3.98810 |
| Vapour Pressure | 5.99E-05mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | ULVYYNCKNGTVHX-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2cc(Cl)ccc2c2ccc(Cl)cc12 |
| HS Code | 2933990090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,8-Dichlor-phenanthridon |
| 3,8-Dichloro-6-phenanthridinol |