Benzoic acid,3-[[(4-methoxyphenyl)methylene]amino]- structure
|
Common Name | Benzoic acid,3-[[(4-methoxyphenyl)methylene]amino]- | ||
|---|---|---|---|---|
| CAS Number | 22774-15-8 | Molecular Weight | 255.26900 | |
| Density | 1.14g/cm3 | Boiling Point | 467.3ºC at 760 mmHg | |
| Molecular Formula | C15H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.4ºC | |
| Name | 3-[(4-methoxyphenyl)methylideneamino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 467.3ºC at 760 mmHg |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.26900 |
| Flash Point | 236.4ºC |
| Exact Mass | 255.09000 |
| PSA | 58.89000 |
| LogP | 3.14400 |
| Vapour Pressure | 1.56E-09mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | USBKEPSOHLWFGK-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=Nc2cccc(C(=O)O)c2)cc1 |
|
~%
Benzoic acid,3-... CAS#:22774-15-8 |
| Literature: Senier; Forster Journal of the Chemical Society, 1915 , vol. 107, p. 1169 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Anisalamino-benzoesaeure |