5-Bromo-4-(1,1-difluoroethyl)-2-fluorobenzaldehyde
Modify Date: 2025-09-09 18:51:27
5-Bromo-4-(1,1-difluoroethyl)-2-fluorobenzaldehyde structure
|
Common Name | 5-Bromo-4-(1,1-difluoroethyl)-2-fluorobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 2278208-22-1 | Molecular Weight | 267.04 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6BrF3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Bromo-4-(1,1-difluoroethyl)-2-fluorobenzaldehyde |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H6BrF3O |
|---|---|
| Molecular Weight | 267.04 |
| InChIKey | JRSWNSKJMJBCMX-UHFFFAOYSA-N |
| SMILES | CC(F)(F)c1cc(F)c(C=O)cc1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2278208-22-1? |
| A: Chinese name of 2278208-22-1 is 2278208-22-1. |
| Q: What is the English name of 5-Bromo-4-(1,1-difluoroethyl)-2-fluorobenzaldehyde? |
| A: The English name of 5-Bromo-4-(1,1-difluoroethyl)-2-fluorobenzaldehyde is 5-Bromo-4-(1,1-difluoroethyl)-2-fluorobenzaldehyde. |
| Q: What is the InChIKey of 5-Bromo-4-(1,1-difluoroethyl)-2-fluorobenzaldehyde? |
| A: InChIKey of 5-Bromo-4-(1,1-difluoroethyl)-2-fluorobenzaldehyde is JRSWNSKJMJBCMX-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5-Bromo-4-(1,1-difluoroethyl)-2-fluorobenzaldehyde? |
| A: CAS number of 5-Bromo-4-(1,1-difluoroethyl)-2-fluorobenzaldehyde is 2278208-22-1. |
| Q: What is the SMILES notation of 5-Bromo-4-(1,1-difluoroethyl)-2-fluorobenzaldehyde? |
| A: SMILES notation of 5-Bromo-4-(1,1-difluoroethyl)-2-fluorobenzaldehyde is CC(F)(F)c1cc(F)c(C=O)cc1Br. |
| Q: What is the molecular weight of 5-Bromo-4-(1,1-difluoroethyl)-2-fluorobenzaldehyde? |
| A: Molecular weight of 5-Bromo-4-(1,1-difluoroethyl)-2-fluorobenzaldehyde is 267.04. |
| Q: What is the molecular formula of 5-Bromo-4-(1,1-difluoroethyl)-2-fluorobenzaldehyde? |
| A: Molecular formula of 5-Bromo-4-(1,1-difluoroethyl)-2-fluorobenzaldehyde is C9H6BrF3O. |