(1,2-dimethyl-6-oxopyridin-4-yl) dimethyl phosphate
Modify Date: 2025-09-19 08:17:25
(1,2-dimethyl-6-oxopyridin-4-yl) dimethyl phosphate structure
|
Common Name | (1,2-dimethyl-6-oxopyridin-4-yl) dimethyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 22787-53-7 | Molecular Weight | 247.18500 | |
| Density | 1.27g/cm3 | Boiling Point | 315.9ºC at 760mmHg | |
| Molecular Formula | C9H14NO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.8ºC | |
| Name | (1,2-dimethyl-6-oxopyridin-4-yl) dimethyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 315.9ºC at 760mmHg |
| Molecular Formula | C9H14NO5P |
| Molecular Weight | 247.18500 |
| Flash Point | 144.8ºC |
| Exact Mass | 247.06100 |
| PSA | 76.57000 |
| LogP | 1.47340 |
| Vapour Pressure | 0.000426mmHg at 25°C |
| Index of Refraction | 1.5 |
| InChIKey | GKIPUVHVWDXDCH-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)Oc1cc(C)n(C)c(=O)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MC-2572 |
| 1,6-dimethyl-2-oxo-1,2-dihydropyridin-4-yl dimethyl phosphate |