1-amino-4-(butan-2-ylamino)anthracene-9,10-dione
Modify Date: 2025-12-12 07:31:11
1-amino-4-(butan-2-ylamino)anthracene-9,10-dione structure
|
Common Name | 1-amino-4-(butan-2-ylamino)anthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 22791-66-8 | Molecular Weight | 294.34800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-amino-4-(butan-2-ylamino)anthracene-9,10-dione |
|---|
| Molecular Formula | C18H18N2O2 |
|---|---|
| Molecular Weight | 294.34800 |
| Exact Mass | 294.13700 |
| PSA | 72.19000 |
| LogP | 3.90880 |
| InChIKey | GZYWRWMNIGASFF-UHFFFAOYSA-N |
| SMILES | CCC(C)Nc1ccc(N)c2c1C(=O)c1ccccc1C2=O |
|
~37%
1-amino-4-(buta... CAS#:22791-66-8 |
| Literature: Yoshida, Katsuhira; Matsuoka, Masaru; Yamashita, Yoshio; Nagamori, Shoichi; Kitao, Teijiro Bulletin of the Chemical Society of Japan, 1980 , vol. 53, # 12 p. 3725 - 3726 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |