5-Amino-biphenyl-3-carboxylic acid dimethylamide
Modify Date: 2026-07-08 19:13:54
5-Amino-biphenyl-3-carboxylic acid dimethylamide structure
|
Common Name | 5-Amino-biphenyl-3-carboxylic acid dimethylamide | ||
|---|---|---|---|---|
| CAS Number | 2279122-43-7 | Molecular Weight | 240.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Amino-biphenyl-3-carboxylic acid dimethylamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H16N2O |
|---|---|
| Molecular Weight | 240.30 |
| InChIKey | JRCPJOXXFXXGKL-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)c1cc(N)cc(-c2ccccc2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5-Amino-biphenyl-3-carboxylic acid dimethylamide? |
| A: The English name of 5-Amino-biphenyl-3-carboxylic acid dimethylamide is 5-Amino-biphenyl-3-carboxylic acid dimethylamide. |
| Q: What is the SMILES notation of 5-Amino-biphenyl-3-carboxylic acid dimethylamide? |
| A: SMILES notation of 5-Amino-biphenyl-3-carboxylic acid dimethylamide is CN(C)C(=O)c1cc(N)cc(-c2ccccc2)c1. |
| Q: What is the Chinese name of 2279122-43-7? |
| A: Chinese name of 2279122-43-7 is 2279122-43-7. |
| Q: What is the InChIKey of 5-Amino-biphenyl-3-carboxylic acid dimethylamide? |
| A: InChIKey of 5-Amino-biphenyl-3-carboxylic acid dimethylamide is JRCPJOXXFXXGKL-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 5-Amino-biphenyl-3-carboxylic acid dimethylamide? |
| A: Molecular formula of 5-Amino-biphenyl-3-carboxylic acid dimethylamide is C15H16N2O. |
| Q: What is the molecular weight of 5-Amino-biphenyl-3-carboxylic acid dimethylamide? |
| A: Molecular weight of 5-Amino-biphenyl-3-carboxylic acid dimethylamide is 240.30. |
| Q: What is the CAS number of 5-Amino-biphenyl-3-carboxylic acid dimethylamide? |
| A: CAS number of 5-Amino-biphenyl-3-carboxylic acid dimethylamide is 2279122-43-7. |