tert-Butyl 7-benzyl-9-oxo-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate structure
|
Common Name | tert-Butyl 7-benzyl-9-oxo-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 227940-70-7 | Molecular Weight | 330.421 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 455.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H26N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.5±28.7 °C | |
| Name | tert-butyl 7-benzyl-9-oxo-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 455.9±45.0 °C at 760 mmHg |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.421 |
| Flash Point | 229.5±28.7 °C |
| Exact Mass | 330.194336 |
| PSA | 49.85000 |
| LogP | 2.39 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | NQUQKYBHLOZWLJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CN(Cc3ccccc3)CC(C1)C2=O |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-2-propanyl 7-benzyl-9-oxo-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate |
| 3,7-Diazabicyclo[3.3.1]nonane-3-carboxylic acid, 9-oxo-7-(phenylmethyl)-, 1,1-dimethylethyl ester |
| tert-Butyl 7-benzyl-9-oxo-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate |