Benzenemethanol,4-(1,1-dimethylethyl)-a,a-bis(trifluoromethyl)- structure
|
Common Name | Benzenemethanol,4-(1,1-dimethylethyl)-a,a-bis(trifluoromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 22796-15-2 | Molecular Weight | 300.24000 | |
| Density | 1.269g/cm3 | Boiling Point | 282.3ºC at 760 mmHg | |
| Molecular Formula | C13H14F6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.5ºC | |
| Name | 2-(4-tert-butylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.269g/cm3 |
|---|---|
| Boiling Point | 282.3ºC at 760 mmHg |
| Molecular Formula | C13H14F6O |
| Molecular Weight | 300.24000 |
| Flash Point | 124.5ºC |
| Exact Mass | 300.09500 |
| PSA | 20.23000 |
| LogP | 4.29630 |
| Vapour Pressure | 0.0016mmHg at 25°C |
| Index of Refraction | 1.427 |
| InChIKey | SFLJPJLXJXMIOY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
|
~%
Benzenemethanol... CAS#:22796-15-2 |
| Literature: Gilbert,E.E. Journal of Organic Chemistry, 1970 , vol. 35, p. 850 - 852 |
|
~72%
Benzenemethanol... CAS#:22796-15-2 |
| Literature: Barbarich; Nolan; Tsujioka; Miller; Anderson; Strauss Journal of Fluorine Chemistry, 2001 , vol. 112, # 2 p. 335 - 342 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Hexafluor-2-(p-tert-butylphenyl)-2-propanol |
| 1,1,1,3,3,3-hexafluoro-2-(p-tert-butyl)phenyl-2-propanol |
| 4-t-Butyl-(hexafluoro-2-hydroxy-2-propyl)-benzol |
| 1,1,1,3,3,3-hexafluoro-2-(4-tert-butylphenyl)-2-propanol |