4-hydroxy-3-nonylnaphthalene-1,2-dione structure
|
Common Name | 4-hydroxy-3-nonylnaphthalene-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 22799-68-4 | Molecular Weight | 300.39200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-hydroxy-3-nonylnaphthalene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H24O3 |
|---|---|
| Molecular Weight | 300.39200 |
| Exact Mass | 300.17300 |
| PSA | 54.37000 |
| LogP | 4.86180 |
| InChIKey | SLGDVSGIYBSSDY-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC1=C(O)c2ccccc2C(=O)C1=O |
|
~%
4-hydroxy-3-non... CAS#:22799-68-4 |
| Literature: Fieser et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 3177 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Name: In vitro concentration required to reduce the proportion of schizont infected cells i...
Source: ChEMBL
Target: Theileria parva
External Id: CHEMBL811437
|
| 2-n-nonyl-3-hydroxy-1,4-naphthoquinone |
| 2-hydroxy-3-n-nonyl-1,4-naphthoquinone |
| 1,4-Naphthalenedione,2-hydroxy-3-nonyl |