ethyl 2-hydroxy-3-(2-nitroimidazol-1-yl)propanoate structure
|
Common Name | ethyl 2-hydroxy-3-(2-nitroimidazol-1-yl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 22813-49-6 | Molecular Weight | 229.19000 | |
| Density | 1.48g/cm3 | Boiling Point | 466.2ºC at 760mmHg | |
| Molecular Formula | C8H11N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.8ºC | |
| Name | ethyl 2-hydroxy-3-(2-nitroimidazol-1-yl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 466.2ºC at 760mmHg |
| Molecular Formula | C8H11N3O5 |
| Molecular Weight | 229.19000 |
| Flash Point | 235.8ºC |
| Exact Mass | 229.07000 |
| PSA | 110.17000 |
| LogP | 0.23850 |
| Vapour Pressure | 1.71E-09mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | HHKHJDRAKMTAIE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(O)Cn1ccnc1[N+](=O)[O-] |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-hydroxy-3-(2-nitro-imidazol-1-yl)-propionic acid ethyl ester |
| Aethyl-3-(2-nitro-1-imidazolyl)-lactat |