Bicyclo2.2.1heptane-2-propanoic acid, 3,3-dimethyl-, ethyl ester structure
|
Common Name | Bicyclo2.2.1heptane-2-propanoic acid, 3,3-dimethyl-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 22833-73-4 | Molecular Weight | 224.33900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3-(3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H24O2 |
|---|---|
| Molecular Weight | 224.33900 |
| Exact Mass | 224.17800 |
| PSA | 26.30000 |
| LogP | 3.40200 |
| InChIKey | JAHDGENQAYQJFL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC1C2CCC(C2)C1(C)C |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Aethyl-3,3-dimethyl-2-norbornanpropionat |