Carbanilic acid,2-fluoro-5-(trifluoromethyl)-, isopropyl ester (7CI,8CI) structure
|
Common Name | Carbanilic acid,2-fluoro-5-(trifluoromethyl)-, isopropyl ester (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 2284-87-9 | Molecular Weight | 265.20400 | |
| Density | 1.326g/cm3 | Boiling Point | 221.6ºC at 760 mmHg | |
| Molecular Formula | C11H11F4NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 87.9ºC | |
| Name | N-<2-Fluor-5-trifluormethyl-phenyl>-carbamidsaeure-ethylester |
|---|
| Density | 1.326g/cm3 |
|---|---|
| Boiling Point | 221.6ºC at 760 mmHg |
| Molecular Formula | C11H11F4NO2 |
| Molecular Weight | 265.20400 |
| Flash Point | 87.9ºC |
| Exact Mass | 265.07300 |
| PSA | 38.33000 |
| LogP | 3.87440 |
| Vapour Pressure | 0.106mmHg at 25°C |
| Index of Refraction | 1.476 |
| InChIKey | SJKKIMHMGRPHDU-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)Nc1cc(C(F)(F)F)ccc1F |
|
~%
Carbanilic acid... CAS#:2284-87-9 |
| Literature: Finger,G.C. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 572 - 573 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |