1,4-Butanedione,2,3-dibromo-1,4-diphenyl- structure
|
Common Name | 1,4-Butanedione,2,3-dibromo-1,4-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 22867-05-6 | Molecular Weight | 396.07300 | |
| Density | 1.646g/cm3 | Boiling Point | 463.5ºC at 760mmHg | |
| Molecular Formula | C16H12Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.5ºC | |
| Name | 1,2-Dibenzoyl-1,2-dibromoethane,2,3-dibromo-1,4-diphenyl-1,4-butanedione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.646g/cm3 |
|---|---|
| Boiling Point | 463.5ºC at 760mmHg |
| Molecular Formula | C16H12Br2O2 |
| Molecular Weight | 396.07300 |
| Flash Point | 120.5ºC |
| Exact Mass | 393.92000 |
| PSA | 34.14000 |
| LogP | 4.27920 |
| Vapour Pressure | 9.02E-09mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | BTCCTQSIHBZYIV-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C(Br)C(Br)C(=O)c1ccccc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2,3-DIBROMO-1,4-DIPHENYL-1,4-BUTANEDIONE |
| 2,3-Dibrom-1,4-diphenyl-butan-1,4-dion |
| 1,2-DIBENZOYL-1,2-DIBROMOETHANE |
| 2,3-dibromo-1,4-diphenyl-butane-1,4-dione |